C44H36 — CID 123877672
9-[4-[3-(5,6-dimethylidenedeca-3,7,9-trien-3-yl)phenyl]phenyl]-10-phenylanthracene (PubChem CID 123877672) has the molecular formula C44H36 and a molecular weight of 564.77 g/mol. Its IUPAC name is 9-[4-[3-(5,6-dimethylidenedeca-3,7,9-trien-3-yl)phenyl]phenyl]-10-phenylanthracene.
| Compound Name | 9-[4-[3-(5,6-dimethylidenedeca-3,7,9-trien-3-yl)phenyl]phenyl]-10-phenylanthracene |
|---|---|
| PubChem CID | 123877672 |
| Molecular Formula | C44H36 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | 9-[4-[3-(5,6-dimethylidenedeca-3,7,9-trien-3-yl)phenyl]phenyl]-10-phenylanthracene |
| SMILES | C=CC=CC(=C)C(=C)C=C(CC)c1cccc(-c2ccc(-c3c4ccccc4c(-c4ccccc4)c4ccccc34)cc2)c1 |
| InChI | InChI=1S/C44H36/c1-5-7-16-31(3)32(4)29-33(6-2)37-19-15-20-38(30-37)34-25-27-36(28-26-34)44-41-23-13-11-21-39(41)43(35-17-9-8-10-18-35)40-22-12-14-24-42(40)44/h5,7-30H,1,3-4,6H2,2H3 |
| InChIKey | PUJINAWUQPEICU-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|