C22H36 — CID 143844790
(3Z)-5,6-dimethylhepta-1,3,5-triene;ethane;prop-1-en-2-ylbenzene (PubChem CID 143844790) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is (3Z)-5,6-dimethylhepta-1,3,5-triene;ethane;prop-1-en-2-ylbenzene.
| Compound Name | (3Z)-5,6-dimethylhepta-1,3,5-triene;ethane;prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 143844790 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | (3Z)-5,6-dimethylhepta-1,3,5-triene;ethane;prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccccc1.C=C/C=C\C(C)=C(C)C.CC.CC |
| InChI | InChI=1S/C9H10.C9H14.2C2H6/c1-8(2)9-6-4-3-5-7-9;1-5-6-7-9(4)8(2)3;2*1-2/h3-7H,1H2,2H3;5-7H,1H2,2-4H3;2*1-2H3/b;7-6-;; |
| InChIKey | MLIFGHMNOHXITO-MLIOTXERSA-N |
| XLogP | 7.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|