C49H35N5 — CID 164817087
(2Z)-1-[6-[6-[4-[2-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-2-pyridinyl]-4-phenyl-2-pyridinyl]penta-2,4-dien-1-imine (PubChem CID 164817087) has the molecular formula C49H35N5 and a molecular weight of 693.85 g/mol. Its IUPAC name is (2Z)-1-[6-[6-[4-[2-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-2-pyridinyl]-4-phenyl-2-pyridinyl]penta-2,4-dien-1-imine.
| Compound Name | (2Z)-1-[6-[6-[4-[2-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-2-pyridinyl]-4-phenyl-2-pyridinyl]penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 164817087 |
| Molecular Formula | C49H35N5 |
| Molecular Weight | 693.85 g/mol |
| Exact Mass | 693.29 |
| IUPAC Name | (2Z)-1-[6-[6-[4-[2-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-2-pyridinyl]-4-phenyl-2-pyridinyl]penta-2,4-dien-1-imine |
| SMILES | [H]/N=C(\C=C/C=C)c1cc(-c2ccccc2)cc(-c2cccc(-c3ccc(-c4ccccc4-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)cc3)n2)n1 |
| InChI | InChI=1S/C49H35N5/c1-2-3-24-42(50)47-31-39(34-16-7-4-8-17-34)32-48(52-47)44-26-15-25-43(51-44)38-29-27-35(28-30-38)40-22-13-14-23-41(40)49-53-45(36-18-9-5-10-19-36)33-46(54-49)37-20-11-6-12-21-37/h2-33,50H,1H2/b24-3-,50-42+ |
| InChIKey | HORANFJZRVZFQG-OLNXQHIVSA-N |
| XLogP | 12.05 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.85 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|