C47H38N2 — CID 145018393
4-[2-[(3Z)-5-methyl-5-phenylhexa-1,3-dien-2-yl]phenyl]-6-phenyl-2-[2-(4-phenylphenyl)phenyl]pyrimidine (PubChem CID 145018393) has the molecular formula C47H38N2 and a molecular weight of 630.84 g/mol. Its IUPAC name is 4-[2-[(3Z)-5-methyl-5-phenylhexa-1,3-dien-2-yl]phenyl]-6-phenyl-2-[2-(4-phenylphenyl)phenyl]pyrimidine.
| Compound Name | 4-[2-[(3Z)-5-methyl-5-phenylhexa-1,3-dien-2-yl]phenyl]-6-phenyl-2-[2-(4-phenylphenyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 145018393 |
| Molecular Formula | C47H38N2 |
| Molecular Weight | 630.84 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | 4-[2-[(3Z)-5-methyl-5-phenylhexa-1,3-dien-2-yl]phenyl]-6-phenyl-2-[2-(4-phenylphenyl)phenyl]pyrimidine |
| SMILES | C=C(/C=C\C(C)(C)c1ccccc1)c1ccccc1-c1cc(-c2ccccc2)nc(-c2ccccc2-c2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C47H38N2/c1-34(31-32-47(2,3)39-21-11-6-12-22-39)40-23-13-15-25-42(40)45-33-44(38-19-9-5-10-20-38)48-46(49-45)43-26-16-14-24-41(43)37-29-27-36(28-30-37)35-17-7-4-8-18-35/h4-33H,1H2,2-3H3/b32-31- |
| InChIKey | BTHRNOCKNYAWBU-MVJHLKBCSA-N |
| XLogP | 12.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.84 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|