C29H21N3S — CID 153310065
7-(4,6-diphenylpyrimidin-2-yl)-2-[(3Z)-hexa-1,3,5-trien-2-yl]-1,3-benzothiazole (PubChem CID 153310065) has the molecular formula C29H21N3S and a molecular weight of 443.58 g/mol. Its IUPAC name is 7-(4,6-diphenylpyrimidin-2-yl)-2-[(3Z)-hexa-1,3,5-trien-2-yl]-1,3-benzothiazole.
| Compound Name | 7-(4,6-diphenylpyrimidin-2-yl)-2-[(3Z)-hexa-1,3,5-trien-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 153310065 |
| Molecular Formula | C29H21N3S |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 7-(4,6-diphenylpyrimidin-2-yl)-2-[(3Z)-hexa-1,3,5-trien-2-yl]-1,3-benzothiazole |
| SMILES | C=C/C=C\C(=C)c1nc2cccc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)c2s1 |
| InChI | InChI=1S/C29H21N3S/c1-3-4-12-20(2)29-32-24-18-11-17-23(27(24)33-29)28-30-25(21-13-7-5-8-14-21)19-26(31-28)22-15-9-6-10-16-22/h3-19H,1-2H2/b12-4- |
| InChIKey | KJEPDBVMORQSPY-QCDXTXTGSA-N |
| XLogP | 7.84 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|