C29H19N3S — CID 153310040
7-(2,6-diphenylpyrimidin-4-yl)-2-phenyl-1,3-benzothiazole (PubChem CID 153310040) has the molecular formula C29H19N3S and a molecular weight of 441.56 g/mol. Its IUPAC name is 7-(2,6-diphenylpyrimidin-4-yl)-2-phenyl-1,3-benzothiazole.
| Compound Name | 7-(2,6-diphenylpyrimidin-4-yl)-2-phenyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 153310040 |
| Molecular Formula | C29H19N3S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 7-(2,6-diphenylpyrimidin-4-yl)-2-phenyl-1,3-benzothiazole |
| SMILES | c1ccc(-c2cc(-c3cccc4nc(-c5ccccc5)sc34)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C29H19N3S/c1-4-11-20(12-5-1)25-19-26(31-28(30-25)21-13-6-2-7-14-21)23-17-10-18-24-27(23)33-29(32-24)22-15-8-3-9-16-22/h1-19H |
| InChIKey | HVMSKFUBHXATOF-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |