C44H28N4S — CID 155328556
2-[6-(2,6-diphenylpyrimidin-4-yl)dibenzothiophen-1-yl]-4,6-diphenylpyrimidine (PubChem CID 155328556) has the molecular formula C44H28N4S and a molecular weight of 644.80 g/mol. Its IUPAC name is 2-[6-(2,6-diphenylpyrimidin-4-yl)dibenzothiophen-1-yl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[6-(2,6-diphenylpyrimidin-4-yl)dibenzothiophen-1-yl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 155328556 |
| Molecular Formula | C44H28N4S |
| Molecular Weight | 644.80 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | 2-[6-(2,6-diphenylpyrimidin-4-yl)dibenzothiophen-1-yl]-4,6-diphenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3cccc4c3sc3cccc(-c5nc(-c6ccccc6)cc(-c6ccccc6)n5)c34)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C44H28N4S/c1-5-15-29(16-6-1)36-27-37(30-17-7-2-8-18-30)47-44(46-36)35-25-14-26-40-41(35)34-24-13-23-33(42(34)49-40)39-28-38(31-19-9-3-10-20-31)45-43(48-39)32-21-11-4-12-22-32/h1-28H |
| InChIKey | HAJVFZMSSXXTKH-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.80 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |