C56H36N4S — CID 155328892
2-[3-[6-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]dibenzothiophen-1-yl]phenyl]-4,6-diphenylpyrimidine (PubChem CID 155328892) has the molecular formula C56H36N4S and a molecular weight of 797.00 g/mol. Its IUPAC name is 2-[3-[6-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]dibenzothiophen-1-yl]phenyl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[3-[6-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]dibenzothiophen-1-yl]phenyl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 155328892 |
| Molecular Formula | C56H36N4S |
| Molecular Weight | 797.00 g/mol |
| Exact Mass | 796.27 |
| IUPAC Name | 2-[3-[6-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]dibenzothiophen-1-yl]phenyl]-4,6-diphenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3cccc(-c4cccc5c4sc4cccc(-c6cccc(-c7nc(-c8ccccc8)cc(-c8ccccc8)n7)c6)c45)c3)n2)cc1 |
| InChI | InChI=1S/C56H36N4S/c1-5-17-37(18-6-1)48-35-49(38-19-7-2-8-20-38)58-55(57-48)43-27-13-25-41(33-43)45-29-16-32-52-53(45)47-31-15-30-46(54(47)61-52)42-26-14-28-44(34-42)56-59-50(39-21-9-3-10-22-39)36-51(60-56)40-23-11-4-12-24-40/h1-36H |
| InChIKey | ZQJGQBFMCJHZKU-UHFFFAOYSA-N |
| XLogP | 14.97 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.00 |
| LogP ≤ 5 | 14.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |