C43H35N5 — CID 166656343
2-[(2Z,4Z)-2-[4-(6-methyl-5,6-dihydronaphthalen-1-yl)-6-phenylpyrimidin-2-yl]hepta-2,4,6-trien-3-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 166656343) has the molecular formula C43H35N5 and a molecular weight of 621.79 g/mol. Its IUPAC name is 2-[(2Z,4Z)-2-[4-(6-methyl-5,6-dihydronaphthalen-1-yl)-6-phenylpyrimidin-2-yl]hepta-2,4,6-trien-3-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[(2Z,4Z)-2-[4-(6-methyl-5,6-dihydronaphthalen-1-yl)-6-phenylpyrimidin-2-yl]hepta-2,4,6-trien-3-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 166656343 |
| Molecular Formula | C43H35N5 |
| Molecular Weight | 621.79 g/mol |
| Exact Mass | 621.29 |
| IUPAC Name | 2-[(2Z,4Z)-2-[4-(6-methyl-5,6-dihydronaphthalen-1-yl)-6-phenylpyrimidin-2-yl]hepta-2,4,6-trien-3-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | C=C/C=C\C(=C(/C)c1nc(-c2ccccc2)cc(-c2cccc3c2C=CC(C)C3)n1)c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C43H35N5/c1-4-5-23-35(43-47-41(32-18-11-7-12-19-32)46-42(48-43)33-20-13-8-14-21-33)30(3)40-44-38(31-16-9-6-10-17-31)28-39(45-40)37-24-15-22-34-27-29(2)25-26-36(34)37/h4-26,28-29H,1,27H2,2-3H3/b23-5-,35-30- |
| InChIKey | KKLUVFJEQFKHCJ-NJLCHWAESA-N |
| XLogP | 10.21 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.79 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|