C37H30N4 — CID 123524728
10-(4-hepta-2,4,6-trien-3-yl-6-phenyl-1,3,5-triazin-2-yl)-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene (PubChem CID 123524728) has the molecular formula C37H30N4 and a molecular weight of 530.68 g/mol. Its IUPAC name is 10-(4-hepta-2,4,6-trien-3-yl-6-phenyl-1,3,5-triazin-2-yl)-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene.
| Compound Name | 10-(4-hepta-2,4,6-trien-3-yl-6-phenyl-1,3,5-triazin-2-yl)-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 123524728 |
| Molecular Formula | C37H30N4 |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 10-(4-hepta-2,4,6-trien-3-yl-6-phenyl-1,3,5-triazin-2-yl)-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
| SMILES | C=CC=CC(=CC)c1nc(-c2ccccc2)nc(-c2cc3c4c(c2)c2ccccc2n4-c2ccccc2C3(C)C)n1 |
| InChI | InChI=1S/C37H30N4/c1-5-7-15-24(6-2)34-38-35(25-16-9-8-10-17-25)40-36(39-34)26-22-28-27-18-11-13-20-31(27)41-32-21-14-12-19-29(32)37(3,4)30(23-26)33(28)41/h5-23H,1H2,2-4H3 |
| InChIKey | UUILDTNCCOBRPW-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|