C22H18BN3 — CID 177242731
CID 177242731 (PubChem CID 177242731) has the molecular formula C22H18BN3 and a molecular weight of 335.22 g/mol.
| Compound Name | CID 177242731 |
|---|---|
| PubChem CID | 177242731 |
| Molecular Formula | C22H18BN3 |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(-c2nc(C(/C=C\C=C)=C/C)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H18BN3/c1-3-5-9-16(4-2)20-24-21(17-10-7-6-8-11-17)26-22(25-20)18-12-14-19(23)15-13-18/h3-15H,1H2,2H3/b9-5-,16-4+ |
| InChIKey | QIQVPJLNPKKTMT-NLKMMNARSA-N |
| XLogP | 4.14 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|