C22H17N3S — CID 142519317
2-dibenzothiophen-3-yl-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,3,5-triazine (PubChem CID 142519317) has the molecular formula C22H17N3S and a molecular weight of 355.47 g/mol. Its IUPAC name is 2-dibenzothiophen-3-yl-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,3,5-triazine.
| Compound Name | 2-dibenzothiophen-3-yl-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 142519317 |
| Molecular Formula | C22H17N3S |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-dibenzothiophen-3-yl-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,3,5-triazine |
| SMILES | C=C/C=C\C(=C/C)c1ncnc(-c2ccc3c(c2)sc2ccccc23)n1 |
| InChI | InChI=1S/C22H17N3S/c1-3-5-8-15(4-2)21-23-14-24-22(25-21)16-11-12-18-17-9-6-7-10-19(17)26-20(18)13-16/h3-14H,1H2,2H3/b8-5-,15-4+ |
| InChIKey | GXJDWNYOLBMVCG-YGIGUCEYSA-N |
| XLogP | 6.05 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|