C45H31N3OS — CID 156706459
2-[3-(8-dibenzothiophen-1-yldibenzofuran-1-yl)phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazine (PubChem CID 156706459) has the molecular formula C45H31N3OS and a molecular weight of 661.83 g/mol. Its IUPAC name is 2-[3-(8-dibenzothiophen-1-yldibenzofuran-1-yl)phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[3-(8-dibenzothiophen-1-yldibenzofuran-1-yl)phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 156706459 |
| Molecular Formula | C45H31N3OS |
| Molecular Weight | 661.83 g/mol |
| Exact Mass | 661.22 |
| IUPAC Name | 2-[3-(8-dibenzothiophen-1-yldibenzofuran-1-yl)phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazine |
| SMILES | C/C=C\C(=C/C)c1nc(-c2ccccc2)nc(-c2cccc(-c3cccc4oc5ccc(-c6cccc7sc8ccccc8c67)cc5c34)c2)n1 |
| InChI | InChI=1S/C45H31N3OS/c1-3-13-28(4-2)43-46-44(29-14-6-5-7-15-29)48-45(47-43)32-17-10-16-30(26-32)33-19-11-21-38-41(33)36-27-31(24-25-37(36)49-38)34-20-12-23-40-42(34)35-18-8-9-22-39(35)50-40/h3-27H,1-2H3/b13-3-,28-4+ |
| InChIKey | KYEDKEXOXADQKG-XPLAKSRISA-N |
| XLogP | 12.79 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.83 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|