C53H42N4O — CID 166096969
ethane;3-[9-[3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]dibenzofuran-2-yl]-9-phenylcarbazole (PubChem CID 166096969) has the molecular formula C53H42N4O and a molecular weight of 750.95 g/mol. Its IUPAC name is ethane;3-[9-[3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]dibenzofuran-2-yl]-9-phenylcarbazole.
| Compound Name | ethane;3-[9-[3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]dibenzofuran-2-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 166096969 |
| Molecular Formula | C53H42N4O |
| Molecular Weight | 750.95 g/mol |
| Exact Mass | 750.34 |
| IUPAC Name | ethane;3-[9-[3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]dibenzofuran-2-yl]-9-phenylcarbazole |
| SMILES | C/C=C\C(=C/C)c1nc(-c2ccccc2)nc(-c2cccc(-c3cccc4oc5ccc(-c6ccc7c(c6)c6ccccc6n7-c6ccccc6)cc5c34)c2)n1.CC |
| InChI | InChI=1S/C51H36N4O.C2H6/c1-3-15-33(4-2)49-52-50(34-16-7-5-8-17-34)54-51(53-49)38-19-13-18-37(30-38)40-23-14-25-47-48(40)43-32-36(27-29-46(43)56-47)35-26-28-45-42(31-35)41-22-11-12-24-44(41)55(45)39-20-9-6-10-21-39;1-2/h3-32H,1-2H3;1-2H3/b15-3-,33-4+; |
| InChIKey | GVSMHDGDXUFCQX-ZHJQZZHJSA-N |
| XLogP | 14.54 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.95 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|