C69H47N5O — CID 154647033
3-[9-[3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]dibenzofuran-2-yl]-9-phenyl-6-(9-phenylcarbazol-3-yl)carbazole (PubChem CID 154647033) has the molecular formula C69H47N5O and a molecular weight of 962.17 g/mol. Its IUPAC name is 3-[9-[3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]dibenzofuran-2-yl]-9-phenyl-6-(9-phenylcarbazol-3-yl)carbazole.
| Compound Name | 3-[9-[3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]dibenzofuran-2-yl]-9-phenyl-6-(9-phenylcarbazol-3-yl)carbazole |
|---|---|
| PubChem CID | 154647033 |
| Molecular Formula | C69H47N5O |
| Molecular Weight | 962.17 g/mol |
| Exact Mass | 961.38 |
| IUPAC Name | 3-[9-[3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]dibenzofuran-2-yl]-9-phenyl-6-(9-phenylcarbazol-3-yl)carbazole |
| SMILES | C/C=C\C(=C/C)c1nc(-c2ccccc2)nc(-c2cccc(-c3cccc4oc5ccc(-c6ccc7c(c6)c6cc(-c8ccc9c(c8)c8ccccc8n9-c8ccccc8)ccc6n7-c6ccccc6)cc5c34)c2)n1 |
| InChI | InChI=1S/C69H47N5O/c1-3-18-44(4-2)67-70-68(45-19-8-5-9-20-45)72-69(71-67)51-22-16-21-50(39-51)54-28-17-30-65-66(54)59-43-49(34-38-64(59)75-65)48-33-37-63-58(42-48)57-41-47(32-36-62(57)74(63)53-25-12-7-13-26-53)46-31-35-61-56(40-46)55-27-14-15-29-60(55)73(61)52-23-10-6-11-24-52/h3-43H,1-2H3/b18-3-,44-4+ |
| InChIKey | NXMDPKJPMNSWSO-LIBVWIETSA-N |
| XLogP | 18.28 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.17 |
| LogP ≤ 5 | 18.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|