C28H17N3S2 — CID 155603296
2,4-di(dibenzothiophen-3-yl)-6-methyl-1,3,5-triazine (PubChem CID 155603296) has the molecular formula C28H17N3S2 and a molecular weight of 459.60 g/mol. Its IUPAC name is 2,4-di(dibenzothiophen-3-yl)-6-methyl-1,3,5-triazine.
| Compound Name | 2,4-di(dibenzothiophen-3-yl)-6-methyl-1,3,5-triazine |
|---|---|
| PubChem CID | 155603296 |
| Molecular Formula | C28H17N3S2 |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 2,4-di(dibenzothiophen-3-yl)-6-methyl-1,3,5-triazine |
| SMILES | Cc1nc(-c2ccc3c(c2)sc2ccccc23)nc(-c2ccc3c(c2)sc2ccccc23)n1 |
| InChI | InChI=1S/C28H17N3S2/c1-16-29-27(17-10-12-21-19-6-2-4-8-23(19)32-25(21)14-17)31-28(30-16)18-11-13-22-20-7-3-5-9-24(20)33-26(22)15-18/h2-15H,1H3 |
| InChIKey | FRLBYZVKWKKYCT-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |