C24H19N3S — CID 158748494
2-dibenzothiophen-3-yl-4-phenyl-6-propan-2-yl-1,3,5-triazine (PubChem CID 158748494) has the molecular formula C24H19N3S and a molecular weight of 381.50 g/mol. Its IUPAC name is 2-dibenzothiophen-3-yl-4-phenyl-6-propan-2-yl-1,3,5-triazine.
| Compound Name | 2-dibenzothiophen-3-yl-4-phenyl-6-propan-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 158748494 |
| Molecular Formula | C24H19N3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-dibenzothiophen-3-yl-4-phenyl-6-propan-2-yl-1,3,5-triazine |
| SMILES | CC(C)c1nc(-c2ccccc2)nc(-c2ccc3c(c2)sc2ccccc23)n1 |
| InChI | InChI=1S/C24H19N3S/c1-15(2)22-25-23(16-8-4-3-5-9-16)27-24(26-22)17-12-13-19-18-10-6-7-11-20(18)28-21(19)14-17/h3-15H,1-2H3 |
| InChIKey | INECWRPMMNLGJS-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |