C48H38N4O — CID 146489182
4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-methyl-6-(6-methyl-5,6-dihydronaphthalen-1-yl)-1,2,5,6-tetrahydro-[1]benzofuro[2,3-c]quinoline (PubChem CID 146489182) has the molecular formula C48H38N4O and a molecular weight of 686.86 g/mol. Its IUPAC name is 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-methyl-6-(6-methyl-5,6-dihydronaphthalen-1-yl)-1,2,5,6-tetrahydro-[1]benzofuro[2,3-c]quinoline.
| Compound Name | 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-methyl-6-(6-methyl-5,6-dihydronaphthalen-1-yl)-1,2,5,6-tetrahydro-[1]benzofuro[2,3-c]quinoline |
|---|---|
| PubChem CID | 146489182 |
| Molecular Formula | C48H38N4O |
| Molecular Weight | 686.86 g/mol |
| Exact Mass | 686.30 |
| IUPAC Name | 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-methyl-6-(6-methyl-5,6-dihydronaphthalen-1-yl)-1,2,5,6-tetrahydro-[1]benzofuro[2,3-c]quinoline |
| SMILES | CC1C=Cc2c(cccc2C2NC3=C(c4c2oc2ccccc42)C(C)CC=C3c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)C1 |
| InChI | InChI=1S/C48H38N4O/c1-29-20-26-36-35(28-29)16-11-18-38(36)44-45-42(39-17-9-10-19-40(39)53-45)41-30(2)21-27-37(43(41)49-44)31-22-24-34(25-23-31)48-51-46(32-12-5-3-6-13-32)50-47(52-48)33-14-7-4-8-15-33/h3-20,22-27,29-30,44,49H,21,28H2,1-2H3 |
| InChIKey | GJHWJJVJYFSRFY-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.86 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |