C9H7F2NO2 — CID 86591919
(1Z)-1-(2,4-difluorophenyl)-1-hydroxyiminopropan-2-one (PubChem CID 86591919) has the molecular formula C9H7F2NO2 and a molecular weight of 199.16 g/mol. Its IUPAC name is (1Z)-1-(2,4-difluorophenyl)-1-hydroxyiminopropan-2-one.
| Compound Name | (1Z)-1-(2,4-difluorophenyl)-1-hydroxyiminopropan-2-one |
|---|---|
| PubChem CID | 86591919 |
| Molecular Formula | C9H7F2NO2 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | (1Z)-1-(2,4-difluorophenyl)-1-hydroxyiminopropan-2-one |
| SMILES | CC(=O)/C(=N\O)c1ccc(F)cc1F |
| InChI | InChI=1S/C9H7F2NO2/c1-5(13)9(12-14)7-3-2-6(10)4-8(7)11/h2-4,14H,1H3/b12-9+ |
| InChIKey | HHZNPSYZWZFAOZ-FMIVXFBMSA-N |
| XLogP | 1.73 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|