C19H10F4N2O3 — CID 140546313
1-(2,6-difluorophenyl)-5-[2-(2,4-difluorophenyl)-2-hydroxyiminoacetyl]pyridin-2-one (PubChem CID 140546313) has the molecular formula C19H10F4N2O3 and a molecular weight of 390.29 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-5-[2-(2,4-difluorophenyl)-2-hydroxyiminoacetyl]pyridin-2-one.
| Compound Name | 1-(2,6-difluorophenyl)-5-[2-(2,4-difluorophenyl)-2-hydroxyiminoacetyl]pyridin-2-one |
|---|---|
| PubChem CID | 140546313 |
| Molecular Formula | C19H10F4N2O3 |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 1-(2,6-difluorophenyl)-5-[2-(2,4-difluorophenyl)-2-hydroxyiminoacetyl]pyridin-2-one |
| SMILES | O=C(C(=NO)c1ccc(F)cc1F)c1ccc(=O)n(-c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C19H10F4N2O3/c20-11-5-6-12(15(23)8-11)17(24-28)19(27)10-4-7-16(26)25(9-10)18-13(21)2-1-3-14(18)22/h1-9,28H |
| InChIKey | JUWJOSWFJAHQDU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|