C19H12Cl2FNO2 — CID 69242900
1-(2,6-dichlorophenyl)-5-(4-fluoro-2-methylbenzoyl)pyridin-2-one (PubChem CID 69242900) has the molecular formula C19H12Cl2FNO2 and a molecular weight of 376.21 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-5-(4-fluoro-2-methylbenzoyl)pyridin-2-one.
| Compound Name | 1-(2,6-dichlorophenyl)-5-(4-fluoro-2-methylbenzoyl)pyridin-2-one |
|---|---|
| PubChem CID | 69242900 |
| Molecular Formula | C19H12Cl2FNO2 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-5-(4-fluoro-2-methylbenzoyl)pyridin-2-one |
| SMILES | Cc1cc(F)ccc1C(=O)c1ccc(=O)n(-c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C19H12Cl2FNO2/c1-11-9-13(22)6-7-14(11)19(25)12-5-8-17(24)23(10-12)18-15(20)3-2-4-16(18)21/h2-10H,1H3 |
| InChIKey | RXQSXGPFNHONJW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |