C20H13Cl2F2N3O3 — CID 87740071
2-[(E)-[[1-(2,6-dichlorophenyl)-6-oxo-3-pyridinyl]-(2,4-difluorophenyl)methylidene]amino]oxyacetamide (PubChem CID 87740071) has the molecular formula C20H13Cl2F2N3O3 and a molecular weight of 452.24 g/mol. Its IUPAC name is 2-[(E)-[[1-(2,6-dichlorophenyl)-6-oxo-3-pyridinyl]-(2,4-difluorophenyl)methylidene]amino]oxyacetamide.
| Compound Name | 2-[(E)-[[1-(2,6-dichlorophenyl)-6-oxo-3-pyridinyl]-(2,4-difluorophenyl)methylidene]amino]oxyacetamide |
|---|---|
| PubChem CID | 87740071 |
| Molecular Formula | C20H13Cl2F2N3O3 |
| Molecular Weight | 452.24 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | 2-[(E)-[[1-(2,6-dichlorophenyl)-6-oxo-3-pyridinyl]-(2,4-difluorophenyl)methylidene]amino]oxyacetamide |
| SMILES | NC(=O)CO/N=C(\c1ccc(=O)n(-c2c(Cl)cccc2Cl)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H13Cl2F2N3O3/c21-14-2-1-3-15(22)20(14)27-9-11(4-7-18(27)29)19(26-30-10-17(25)28)13-6-5-12(23)8-16(13)24/h1-9H,10H2,(H2,25,28)/b26-19+ |
| InChIKey | WXERBJNBSDHHNT-LGUFXXKBSA-N |
| XLogP | 3.68 |
| TPSA | 86.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|