C23H19Cl2F2N3O2 — CID 87740497
1-(2,6-dichlorophenyl)-5-[C-(2,4-difluorophenyl)-N-[(3S)-piperidin-3-yl]oxycarbonimidoyl]pyridin-2-one (PubChem CID 87740497) has the molecular formula C23H19Cl2F2N3O2 and a molecular weight of 478.33 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-5-[C-(2,4-difluorophenyl)-N-[(3S)-piperidin-3-yl]oxycarbonimidoyl]pyridin-2-one.
| Compound Name | 1-(2,6-dichlorophenyl)-5-[C-(2,4-difluorophenyl)-N-[(3S)-piperidin-3-yl]oxycarbonimidoyl]pyridin-2-one |
|---|---|
| PubChem CID | 87740497 |
| Molecular Formula | C23H19Cl2F2N3O2 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-5-[C-(2,4-difluorophenyl)-N-[(3S)-piperidin-3-yl]oxycarbonimidoyl]pyridin-2-one |
| SMILES | O=c1ccc(C(=NO[C@H]2CCCNC2)c2ccc(F)cc2F)cn1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H19Cl2F2N3O2/c24-18-4-1-5-19(25)23(18)30-13-14(6-9-21(30)31)22(17-8-7-15(26)11-20(17)27)29-32-16-3-2-10-28-12-16/h1,4-9,11,13,16,28H,2-3,10,12H2/t16-/m0/s1 |
| InChIKey | HQWFZIYOPQWPPL-INIZCTEOSA-N |
| XLogP | 4.94 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|