C25H23Cl2F2N3O3 — CID 87740148
1-[2,6-dichloro-4-(methoxymethyl)phenyl]-5-[(Z)-C-(2,4-difluorophenyl)-N-piperidin-4-yloxycarbonimidoyl]pyridin-2-one (PubChem CID 87740148) has the molecular formula C25H23Cl2F2N3O3 and a molecular weight of 522.38 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-(methoxymethyl)phenyl]-5-[(Z)-C-(2,4-difluorophenyl)-N-piperidin-4-yloxycarbonimidoyl]pyridin-2-one.
| Compound Name | 1-[2,6-dichloro-4-(methoxymethyl)phenyl]-5-[(Z)-C-(2,4-difluorophenyl)-N-piperidin-4-yloxycarbonimidoyl]pyridin-2-one |
|---|---|
| PubChem CID | 87740148 |
| Molecular Formula | C25H23Cl2F2N3O3 |
| Molecular Weight | 522.38 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 1-[2,6-dichloro-4-(methoxymethyl)phenyl]-5-[(Z)-C-(2,4-difluorophenyl)-N-piperidin-4-yloxycarbonimidoyl]pyridin-2-one |
| SMILES | COCc1cc(Cl)c(-n2cc(/C(=N/OC3CCNCC3)c3ccc(F)cc3F)ccc2=O)c(Cl)c1 |
| InChI | InChI=1S/C25H23Cl2F2N3O3/c1-34-14-15-10-20(26)25(21(27)11-15)32-13-16(2-5-23(32)33)24(19-4-3-17(28)12-22(19)29)31-35-18-6-8-30-9-7-18/h2-5,10-13,18,30H,6-9,14H2,1H3/b31-24- |
| InChIKey | PNEOGWAYBWBPIN-QLTSDVKISA-N |
| XLogP | 5.09 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|