C20H16F2N2O2 — CID 87741851
5-[(E)-C-(2,4-difluorophenyl)-N-hydroxycarbonimidoyl]-1-(2,6-dimethylphenyl)pyridin-2-one (PubChem CID 87741851) has the molecular formula C20H16F2N2O2 and a molecular weight of 354.36 g/mol. Its IUPAC name is 5-[(E)-C-(2,4-difluorophenyl)-N-hydroxycarbonimidoyl]-1-(2,6-dimethylphenyl)pyridin-2-one.
| Compound Name | 5-[(E)-C-(2,4-difluorophenyl)-N-hydroxycarbonimidoyl]-1-(2,6-dimethylphenyl)pyridin-2-one |
|---|---|
| PubChem CID | 87741851 |
| Molecular Formula | C20H16F2N2O2 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 5-[(E)-C-(2,4-difluorophenyl)-N-hydroxycarbonimidoyl]-1-(2,6-dimethylphenyl)pyridin-2-one |
| SMILES | Cc1cccc(C)c1-n1cc(/C(=N\O)c2ccc(F)cc2F)ccc1=O |
| InChI | InChI=1S/C20H16F2N2O2/c1-12-4-3-5-13(2)20(12)24-11-14(6-9-18(24)25)19(23-26)16-8-7-15(21)10-17(16)22/h3-11,26H,1-2H3/b23-19+ |
| InChIKey | ILLCQZHTCISTSZ-FCDQGJHFSA-N |
| XLogP | 3.96 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|