C10H8F2O2Se — CID 151033646
Se-(2-oxopropyl) 2,4-difluorobenzenecarboselenoate (PubChem CID 151033646) has the molecular formula C10H8F2O2Se and a molecular weight of 277.13 g/mol. Its IUPAC name is Se-(2-oxopropyl) 2,4-difluorobenzenecarboselenoate.
| Compound Name | Se-(2-oxopropyl) 2,4-difluorobenzenecarboselenoate |
|---|---|
| PubChem CID | 151033646 |
| Molecular Formula | C10H8F2O2Se |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | Se-(2-oxopropyl) 2,4-difluorobenzenecarboselenoate |
| SMILES | CC(=O)C[Se]C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H8F2O2Se/c1-6(13)5-15-10(14)8-3-2-7(11)4-9(8)12/h2-4H,5H2,1H3 |
| InChIKey | MAPFKGCKKOVBOI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|