C11H12F2O — CID 43160006
1-(2,4-difluorophenyl)-2-methylbutan-1-one (PubChem CID 43160006) has the molecular formula C11H12F2O and a molecular weight of 198.21 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-methylbutan-1-one.
| Compound Name | 1-(2,4-difluorophenyl)-2-methylbutan-1-one |
|---|---|
| PubChem CID | 43160006 |
| Molecular Formula | C11H12F2O |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-methylbutan-1-one |
| SMILES | CCC(C)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H12F2O/c1-3-7(2)11(14)9-5-4-8(12)6-10(9)13/h4-7H,3H2,1-2H3 |
| InChIKey | FDNCJYVDAUVDAM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |