C10H6F2O5 — CID 19379743
2-(2,4-difluorobenzoyl)propanedioic acid (PubChem CID 19379743) has the molecular formula C10H6F2O5 and a molecular weight of 244.15 g/mol. Its IUPAC name is 2-(2,4-difluorobenzoyl)propanedioic acid.
| Compound Name | 2-(2,4-difluorobenzoyl)propanedioic acid |
|---|---|
| PubChem CID | 19379743 |
| Molecular Formula | C10H6F2O5 |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 2-(2,4-difluorobenzoyl)propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H6F2O5/c11-4-1-2-5(6(12)3-4)8(13)7(9(14)15)10(16)17/h1-3,7H,(H,14,15)(H,16,17) |
| InChIKey | HHJUCJTZWVUKOM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|