C14H14F2 — CID 143262022
acetylene;1,4-difluoro-2-[(2E,4Z)-hexa-2,4-dien-3-yl]benzene (PubChem CID 143262022) has the molecular formula C14H14F2 and a molecular weight of 220.26 g/mol. Its IUPAC name is acetylene;1,4-difluoro-2-[(2E,4Z)-hexa-2,4-dien-3-yl]benzene.
| Compound Name | acetylene;1,4-difluoro-2-[(2E,4Z)-hexa-2,4-dien-3-yl]benzene |
|---|---|
| PubChem CID | 143262022 |
| Molecular Formula | C14H14F2 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | acetylene;1,4-difluoro-2-[(2E,4Z)-hexa-2,4-dien-3-yl]benzene |
| SMILES | C#C.C/C=C\C(=C/C)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H12F2.C2H2/c1-3-5-9(4-2)11-8-10(13)6-7-12(11)14;1-2/h3-8H,1-2H3;1-2H/b5-3-,9-4+; |
| InChIKey | VIHTXBWRLKLAHA-XNDFSMPPSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|