C10H6F2O — CID 63661122
1-(2,5-difluorophenyl)but-3-yn-1-one (PubChem CID 63661122) has the molecular formula C10H6F2O and a molecular weight of 180.15 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)but-3-yn-1-one.
| Compound Name | 1-(2,5-difluorophenyl)but-3-yn-1-one |
|---|---|
| PubChem CID | 63661122 |
| Molecular Formula | C10H6F2O |
| Molecular Weight | 180.15 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 1-(2,5-difluorophenyl)but-3-yn-1-one |
| SMILES | C#CCC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C10H6F2O/c1-2-3-10(13)8-6-7(11)4-5-9(8)12/h1,4-6H,3H2 |
| InChIKey | LLKMDBZOPVEZKX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.15 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|