C11H10F2NOP — CID 118401904
1-(2,5-difluorophenyl)-2-(phosphanylamino)pent-4-yn-1-one (PubChem CID 118401904) has the molecular formula C11H10F2NOP and a molecular weight of 241.18 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-(phosphanylamino)pent-4-yn-1-one.
| Compound Name | 1-(2,5-difluorophenyl)-2-(phosphanylamino)pent-4-yn-1-one |
|---|---|
| PubChem CID | 118401904 |
| Molecular Formula | C11H10F2NOP |
| Molecular Weight | 241.18 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-(phosphanylamino)pent-4-yn-1-one |
| SMILES | C#CCC(NP)C(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H10F2NOP/c1-2-3-10(14-16)11(15)8-6-7(12)4-5-9(8)13/h1,4-6,10,14H,3,16H2 |
| InChIKey | IUOZLKFIFPAQIM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|