C13H16F2O2 — CID 103458391
1-(2,5-difluorophenyl)-3-ethyl-2-hydroxypentan-1-one (PubChem CID 103458391) has the molecular formula C13H16F2O2 and a molecular weight of 242.26 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-ethyl-2-hydroxypentan-1-one.
| Compound Name | 1-(2,5-difluorophenyl)-3-ethyl-2-hydroxypentan-1-one |
|---|---|
| PubChem CID | 103458391 |
| Molecular Formula | C13H16F2O2 |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-ethyl-2-hydroxypentan-1-one |
| SMILES | CCC(CC)C(O)C(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H16F2O2/c1-3-8(4-2)12(16)13(17)10-7-9(14)5-6-11(10)15/h5-8,12,16H,3-4H2,1-2H3 |
| InChIKey | LXRUYXWLPNENHV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |