C13H16F2OS — CID 107752657
1-(2,5-difluorophenyl)-2-(2-methylbutylsulfanyl)ethanone (PubChem CID 107752657) has the molecular formula C13H16F2OS and a molecular weight of 258.33 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-(2-methylbutylsulfanyl)ethanone.
| Compound Name | 1-(2,5-difluorophenyl)-2-(2-methylbutylsulfanyl)ethanone |
|---|---|
| PubChem CID | 107752657 |
| Molecular Formula | C13H16F2OS |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-(2-methylbutylsulfanyl)ethanone |
| SMILES | CCC(C)CSCC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H16F2OS/c1-3-9(2)7-17-8-13(16)11-6-10(14)4-5-12(11)15/h4-6,9H,3,7-8H2,1-2H3 |
| InChIKey | DQTNTJPZMOXLQR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |