C11H13F2NO3S — CID 116551905
2-amino-1-(2,5-difluorophenyl)-4-methylsulfonylbutan-1-one (PubChem CID 116551905) has the molecular formula C11H13F2NO3S and a molecular weight of 277.29 g/mol. Its IUPAC name is 2-amino-1-(2,5-difluorophenyl)-4-methylsulfonylbutan-1-one.
| Compound Name | 2-amino-1-(2,5-difluorophenyl)-4-methylsulfonylbutan-1-one |
|---|---|
| PubChem CID | 116551905 |
| Molecular Formula | C11H13F2NO3S |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-amino-1-(2,5-difluorophenyl)-4-methylsulfonylbutan-1-one |
| SMILES | CS(=O)(=O)CCC(N)C(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H13F2NO3S/c1-18(16,17)5-4-10(14)11(15)8-6-7(12)2-3-9(8)13/h2-3,6,10H,4-5,14H2,1H3 |
| InChIKey | YYQYLGYSOGAADW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |