C11H11F2NO — CID 116606859
2-amino-1-(2,5-difluorophenyl)pent-4-en-1-one (PubChem CID 116606859) has the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. Its IUPAC name is 2-amino-1-(2,5-difluorophenyl)pent-4-en-1-one.
| Compound Name | 2-amino-1-(2,5-difluorophenyl)pent-4-en-1-one |
|---|---|
| PubChem CID | 116606859 |
| Molecular Formula | C11H11F2NO |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-amino-1-(2,5-difluorophenyl)pent-4-en-1-one |
| SMILES | C=CCC(N)C(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H11F2NO/c1-2-3-10(14)11(15)8-6-7(12)4-5-9(8)13/h2,4-6,10H,1,3,14H2 |
| InChIKey | OLMHHVMLLRKYIQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|