C10H13N3O — CID 116607098
2-amino-1-(2-amino-3-pyridinyl)pent-4-en-1-one (PubChem CID 116607098) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-amino-1-(2-amino-3-pyridinyl)pent-4-en-1-one.
| Compound Name | 2-amino-1-(2-amino-3-pyridinyl)pent-4-en-1-one |
|---|---|
| PubChem CID | 116607098 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-amino-1-(2-amino-3-pyridinyl)pent-4-en-1-one |
| SMILES | C=CCC(N)C(=O)c1cccnc1N |
| InChI | InChI=1S/C10H13N3O/c1-2-4-8(11)9(14)7-5-3-6-13-10(7)12/h2-3,5-6,8H,1,4,11H2,(H2,12,13) |
| InChIKey | GPFFTFWJRIJEQS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|