C12H13ClFNO — CID 116606977
3-amino-1-(2-chloro-4-fluorophenyl)hex-5-en-2-one (PubChem CID 116606977) has the molecular formula C12H13ClFNO and a molecular weight of 241.69 g/mol. Its IUPAC name is 3-amino-1-(2-chloro-4-fluorophenyl)hex-5-en-2-one.
| Compound Name | 3-amino-1-(2-chloro-4-fluorophenyl)hex-5-en-2-one |
|---|---|
| PubChem CID | 116606977 |
| Molecular Formula | C12H13ClFNO |
| Molecular Weight | 241.69 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 3-amino-1-(2-chloro-4-fluorophenyl)hex-5-en-2-one |
| SMILES | C=CCC(N)C(=O)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C12H13ClFNO/c1-2-3-11(15)12(16)6-8-4-5-9(14)7-10(8)13/h2,4-5,7,11H,1,3,6,15H2 |
| InChIKey | ABDAKCYMZJLMLS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.69 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|