C15H20ClFO2 — CID 116710056
1-(2-chloro-4-fluorophenyl)-3-ethoxy-4,4-dimethylpentan-2-one (PubChem CID 116710056) has the molecular formula C15H20ClFO2 and a molecular weight of 286.77 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-3-ethoxy-4,4-dimethylpentan-2-one.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-3-ethoxy-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 116710056 |
| Molecular Formula | C15H20ClFO2 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-3-ethoxy-4,4-dimethylpentan-2-one |
| SMILES | CCOC(C(=O)Cc1ccc(F)cc1Cl)C(C)(C)C |
| InChI | InChI=1S/C15H20ClFO2/c1-5-19-14(15(2,3)4)13(18)8-10-6-7-11(17)9-12(10)16/h6-7,9,14H,5,8H2,1-4H3 |
| InChIKey | ORRCTHOBYDTAKI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |