C12H16ClFO2 — CID 146004647
2-chloro-1-(2,2-diethoxyethyl)-4-fluorobenzene (PubChem CID 146004647) has the molecular formula C12H16ClFO2 and a molecular weight of 246.71 g/mol. Its IUPAC name is 2-chloro-1-(2,2-diethoxyethyl)-4-fluorobenzene.
| Compound Name | 2-chloro-1-(2,2-diethoxyethyl)-4-fluorobenzene |
|---|---|
| PubChem CID | 146004647 |
| Molecular Formula | C12H16ClFO2 |
| Molecular Weight | 246.71 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-chloro-1-(2,2-diethoxyethyl)-4-fluorobenzene |
| SMILES | CCOC(Cc1ccc(F)cc1Cl)OCC |
| InChI | InChI=1S/C12H16ClFO2/c1-3-15-12(16-4-2)7-9-5-6-10(14)8-11(9)13/h5-6,8,12H,3-4,7H2,1-2H3 |
| InChIKey | XDSPCYOXTIXICU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.71 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|