C17H26O2 — CID 116710029
1-(3,5-dimethylphenyl)-3-ethoxy-4,4-dimethylpentan-2-one (PubChem CID 116710029) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-ethoxy-4,4-dimethylpentan-2-one.
| Compound Name | 1-(3,5-dimethylphenyl)-3-ethoxy-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 116710029 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-ethoxy-4,4-dimethylpentan-2-one |
| SMILES | CCOC(C(=O)Cc1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C17H26O2/c1-7-19-16(17(4,5)6)15(18)11-14-9-12(2)8-13(3)10-14/h8-10,16H,7,11H2,1-6H3 |
| InChIKey | OVUMCTKUNDDCJA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |