C15H17F2NO3 — CID 82349448
methyl 5-(2,5-difluorophenyl)-5-oxo-4-(prop-2-enylamino)pentanoate (PubChem CID 82349448) has the molecular formula C15H17F2NO3 and a molecular weight of 297.30 g/mol. Its IUPAC name is methyl 5-(2,5-difluorophenyl)-5-oxo-4-(prop-2-enylamino)pentanoate.
| Compound Name | methyl 5-(2,5-difluorophenyl)-5-oxo-4-(prop-2-enylamino)pentanoate |
|---|---|
| PubChem CID | 82349448 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | methyl 5-(2,5-difluorophenyl)-5-oxo-4-(prop-2-enylamino)pentanoate |
| SMILES | C=CCNC(CCC(=O)OC)C(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H17F2NO3/c1-3-8-18-13(6-7-14(19)21-2)15(20)11-9-10(16)4-5-12(11)17/h3-5,9,13,18H,1,6-8H2,2H3 |
| InChIKey | XXPBYSBCGVGPII-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|