C10H8FNO2 — CID 63674509
5-fluoro-2-(prop-2-ynylamino)benzoic acid (PubChem CID 63674509) has the molecular formula C10H8FNO2 and a molecular weight of 193.18 g/mol. Its IUPAC name is 5-fluoro-2-(prop-2-ynylamino)benzoic acid.
| Compound Name | 5-fluoro-2-(prop-2-ynylamino)benzoic acid |
|---|---|
| PubChem CID | 63674509 |
| Molecular Formula | C10H8FNO2 |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 5-fluoro-2-(prop-2-ynylamino)benzoic acid |
| SMILES | C#CCNc1ccc(F)cc1C(=O)O |
| InChI | InChI=1S/C10H8FNO2/c1-2-5-12-9-4-3-7(11)6-8(9)10(13)14/h1,3-4,6,12H,5H2,(H,13,14) |
| InChIKey | HSJPIIJVLZHTIM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|