C12H15ClNO3P — CID 171478826
5-dimethylphosphoryl-2-(prop-2-ynylamino)benzoic acid;hydrochloride (PubChem CID 171478826) has the molecular formula C12H15ClNO3P and a molecular weight of 287.68 g/mol. Its IUPAC name is 5-dimethylphosphoryl-2-(prop-2-ynylamino)benzoic acid;hydrochloride.
| Compound Name | 5-dimethylphosphoryl-2-(prop-2-ynylamino)benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 171478826 |
| Molecular Formula | C12H15ClNO3P |
| Molecular Weight | 287.68 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 5-dimethylphosphoryl-2-(prop-2-ynylamino)benzoic acid;hydrochloride |
| SMILES | C#CCNc1ccc(P(C)(C)=O)cc1C(=O)O.Cl |
| InChI | InChI=1S/C12H14NO3P.ClH/c1-4-7-13-11-6-5-9(17(2,3)16)8-10(11)12(14)15;/h1,5-6,8,13H,7H2,2-3H3,(H,14,15);1H |
| InChIKey | UCJRMOXGDAGPCZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.68 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|