C8H6F2S — CID 143795171
1-(2,5-difluorophenyl)ethanethione (PubChem CID 143795171) has the molecular formula C8H6F2S and a molecular weight of 172.20 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)ethanethione.
| Compound Name | 1-(2,5-difluorophenyl)ethanethione |
|---|---|
| PubChem CID | 143795171 |
| Molecular Formula | C8H6F2S |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.02 |
| IUPAC Name | 1-(2,5-difluorophenyl)ethanethione |
| SMILES | CC(=S)c1cc(F)ccc1F |
| InChI | InChI=1S/C8H6F2S/c1-5(11)7-4-6(9)2-3-8(7)10/h2-4H,1H3 |
| InChIKey | OYPMVPISHFCAQQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|