C11H13F2NS — CID 143795186
N-butan-2-yl-2,5-difluorobenzenecarbothioamide (PubChem CID 143795186) has the molecular formula C11H13F2NS and a molecular weight of 229.29 g/mol. Its IUPAC name is N-butan-2-yl-2,5-difluorobenzenecarbothioamide.
| Compound Name | N-butan-2-yl-2,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 143795186 |
| Molecular Formula | C11H13F2NS |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | N-butan-2-yl-2,5-difluorobenzenecarbothioamide |
| SMILES | CCC(C)NC(=S)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H13F2NS/c1-3-7(2)14-11(15)9-6-8(12)4-5-10(9)13/h4-7H,3H2,1-2H3,(H,14,15) |
| InChIKey | ITSTUURFBXBHMJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|