C13H15F2NS — CID 90748104
pent-3-enyl 2,5-difluoro-N-methylbenzenecarboximidothioate (PubChem CID 90748104) has the molecular formula C13H15F2NS and a molecular weight of 255.33 g/mol. Its IUPAC name is pent-3-enyl 2,5-difluoro-N-methylbenzenecarboximidothioate.
| Compound Name | pent-3-enyl 2,5-difluoro-N-methylbenzenecarboximidothioate |
|---|---|
| PubChem CID | 90748104 |
| Molecular Formula | C13H15F2NS |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | pent-3-enyl 2,5-difluoro-N-methylbenzenecarboximidothioate |
| SMILES | CC=CCCS/C(=N\C)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H15F2NS/c1-3-4-5-8-17-13(16-2)11-9-10(14)6-7-12(11)15/h3-4,6-7,9H,5,8H2,1-2H3/b4-3?,16-13- |
| InChIKey | MYKHJJPQELKHKY-XEOHAQSOSA-N |
| XLogP | 4.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|