C12H12F2O2 — CID 76938295
2-but-2-enoxy-1-(2,5-difluorophenyl)ethanone (PubChem CID 76938295) has the molecular formula C12H12F2O2 and a molecular weight of 226.22 g/mol. Its IUPAC name is 2-but-2-enoxy-1-(2,5-difluorophenyl)ethanone.
| Compound Name | 2-but-2-enoxy-1-(2,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 76938295 |
| Molecular Formula | C12H12F2O2 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-but-2-enoxy-1-(2,5-difluorophenyl)ethanone |
| SMILES | CC=CCOCC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H12F2O2/c1-2-3-6-16-8-12(15)10-7-9(13)4-5-11(10)14/h2-5,7H,6,8H2,1H3 |
| InChIKey | LZZQKFBRBPFGQH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|