C12H16O2S — CID 76938323
2-but-2-enoxy-1-(2,5-dimethylthiophen-3-yl)ethanone (PubChem CID 76938323) has the molecular formula C12H16O2S and a molecular weight of 224.32 g/mol. Its IUPAC name is 2-but-2-enoxy-1-(2,5-dimethylthiophen-3-yl)ethanone.
| Compound Name | 2-but-2-enoxy-1-(2,5-dimethylthiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 76938323 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-but-2-enoxy-1-(2,5-dimethylthiophen-3-yl)ethanone |
| SMILES | CC=CCOCC(=O)c1cc(C)sc1C |
| InChI | InChI=1S/C12H16O2S/c1-4-5-6-14-8-12(13)11-7-9(2)15-10(11)3/h4-5,7H,6,8H2,1-3H3 |
| InChIKey | XORXUUVTECLDJW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|