C14H22O3S — CID 43800187
2-(2-butoxyethoxy)-1-(2,5-dimethylthiophen-3-yl)ethanone (PubChem CID 43800187) has the molecular formula C14H22O3S and a molecular weight of 270.39 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)-1-(2,5-dimethylthiophen-3-yl)ethanone.
| Compound Name | 2-(2-butoxyethoxy)-1-(2,5-dimethylthiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 43800187 |
| Molecular Formula | C14H22O3S |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-(2-butoxyethoxy)-1-(2,5-dimethylthiophen-3-yl)ethanone |
| SMILES | CCCCOCCOCC(=O)c1cc(C)sc1C |
| InChI | InChI=1S/C14H22O3S/c1-4-5-6-16-7-8-17-10-14(15)13-9-11(2)18-12(13)3/h9H,4-8,10H2,1-3H3 |
| InChIKey | XABQFMNAGQLTMB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|