C18H34N2 — CID 142094947
ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]benzene-1,3-diamine (PubChem CID 142094947) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]benzene-1,3-diamine.
| Compound Name | ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 142094947 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]benzene-1,3-diamine |
| SMILES | C/C=C\C(=C/C)c1ccc(N)cc1N.CC.CC.CC |
| InChI | InChI=1S/C12H16N2.3C2H6/c1-3-5-9(4-2)11-7-6-10(13)8-12(11)14;3*1-2/h3-8H,13-14H2,1-2H3;3*1-2H3/b5-3-,9-4+;;; |
| InChIKey | OBIDCLHNLWCRDM-HJBNMGMGSA-N |
| XLogP | 5.91 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|